2-(4-tert-butylphenoxy)ethyl acetate

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

β-(p-tert-butylphenoxy)ethyl acetate; 2-(4-tert-butylphenoxy)ethyl acetate
CAS RN:[6807-12-1]
Formula:C14H20O3; 236.31 g/mol
InChiKey:WYQODQADGFDSGS-UHFFFAOYSA-N
SMILES:CC(=O)OCCOc1ccc(cc1)C(C)(C)C
Molecular structure of 2-(4-tert-butylphenoxy)ethyl acetate
Density:1.024 g/mL
Molar volume:230.8 mL/mol
Boiling point:304 °C
Antoine equation
P(Torr) vs T(°C)		Vapour pressure vs temperature

Isomers

2-(4-tert-butylphenoxy)ethyl acetate
Molecular structure of 2-(4-tert-butylphenoxy)ethyl acetate
ethyl 2-(2,4-dimethylphenoxy)-2-methylpropanoate
Molecular structure of ethyl 2-(2,4-dimethylphenoxy)-2-methylpropanoate
heptyl 4-hydroxybenzoate
Molecular structure of heptyl 4-hydroxybenzoate
4-heptyloxybenzoic acid
Molecular structure of 4-heptyloxybenzoic acid
2-(4-hexoxyphenyl)acetic acid
Molecular structure of 2-(4-hexoxyphenyl)acetic acid
  ::